C15H21F12NO3S — CID 175160070
2,3,4,5,6,7,8,9,10,11,12,12-dodecafluorododecane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175160070) has the molecular formula C15H21F12NO3S and a molecular weight of 523.38 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,12-dodecafluorododecane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,12-dodecafluorododecane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175160070 |
| Molecular Formula | C15H21F12NO3S |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,12-dodecafluorododecane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)CC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C12H14F12O3S.C3H7N/c13-2(1-28(25,26)27)3(14)4(15)5(16)6(17)7(18)8(19)9(20)10(21)11(22)12(23)24;1-2-3-4/h2-12H,1H2,(H,25,26,27);2H,1,3-4H2 |
| InChIKey | IZKCEJZEPSFQGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|