C12H25F2NO3S — CID 175169891
9,9-difluorononane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175169891) has the molecular formula C12H25F2NO3S and a molecular weight of 301.40 g/mol. Its IUPAC name is 9,9-difluorononane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 9,9-difluorononane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175169891 |
| Molecular Formula | C12H25F2NO3S |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 9,9-difluorononane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)CCCCCCCCC(F)F |
| InChI | InChI=1S/C9H18F2O3S.C3H7N/c10-9(11)7-5-3-1-2-4-6-8-15(12,13)14;1-2-3-4/h9H,1-8H2,(H,12,13,14);2H,1,3-4H2 |
| InChIKey | GKQAPAKOJJPGEC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|