C9H5F11O3 — CID 88517162
[1,2,2,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] prop-2-enoate (PubChem CID 88517162) has the molecular formula C9H5F11O3 and a molecular weight of 370.11 g/mol. Its IUPAC name is [1,2,2,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] prop-2-enoate.
| Compound Name | [1,2,2,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 88517162 |
| Molecular Formula | C9H5F11O3 |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | [1,2,2,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(F)C(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F11O3/c1-2-3(21)22-4(10)6(12,13)5(11)23-9(19,20)7(14,15)8(16,17)18/h2,4-5H,1H2 |
| InChIKey | NEBILMIAJNZHJB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|