C17H24F4O6 — CID 88573470
1-O-(2,4-dimethylpentan-3-yl) 5-O-(2-prop-2-enoyloxyethyl) 2,2,4,4-tetrafluoropentanedioate (PubChem CID 88573470) has the molecular formula C17H24F4O6 and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-O-(2,4-dimethylpentan-3-yl) 5-O-(2-prop-2-enoyloxyethyl) 2,2,4,4-tetrafluoropentanedioate.
| Compound Name | 1-O-(2,4-dimethylpentan-3-yl) 5-O-(2-prop-2-enoyloxyethyl) 2,2,4,4-tetrafluoropentanedioate |
|---|---|
| PubChem CID | 88573470 |
| Molecular Formula | C17H24F4O6 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-O-(2,4-dimethylpentan-3-yl) 5-O-(2-prop-2-enoyloxyethyl) 2,2,4,4-tetrafluoropentanedioate |
| SMILES | C=CC(=O)OCCOC(=O)C(F)(F)CC(F)(F)C(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C17H24F4O6/c1-6-12(22)25-7-8-26-14(23)16(18,19)9-17(20,21)15(24)27-13(10(2)3)11(4)5/h6,10-11,13H,1,7-9H2,2-5H3 |
| InChIKey | QGOOMVULRCEWPW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|