C10H15NO4 — CID 87556945
[3-oxo-1-(prop-2-enoylamino)pentyl] acetate (PubChem CID 87556945) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is [3-oxo-1-(prop-2-enoylamino)pentyl] acetate.
| Compound Name | [3-oxo-1-(prop-2-enoylamino)pentyl] acetate |
|---|---|
| PubChem CID | 87556945 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [3-oxo-1-(prop-2-enoylamino)pentyl] acetate |
| SMILES | C=CC(=O)NC(CC(=O)CC)OC(C)=O |
| InChI | InChI=1S/C10H15NO4/c1-4-8(13)6-10(15-7(3)12)11-9(14)5-2/h5,10H,2,4,6H2,1,3H3,(H,11,14) |
| InChIKey | FUXGHLZEEOPMJY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|