C7H11NO2 — CID 130198030
(3R)-1-amino-3-methylhex-5-ene-2,4-dione (PubChem CID 130198030) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (3R)-1-amino-3-methylhex-5-ene-2,4-dione.
| Compound Name | (3R)-1-amino-3-methylhex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 130198030 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3R)-1-amino-3-methylhex-5-ene-2,4-dione |
| SMILES | C=CC(=O)[C@@H](C)C(=O)CN |
| InChI | InChI=1S/C7H11NO2/c1-3-6(9)5(2)7(10)4-8/h3,5H,1,4,8H2,2H3/t5-/m1/s1 |
| InChIKey | VIKHQCMUWQNJKY-RXMQYKEDSA-N |
| XLogP | -0.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|