C4H10N2O — CID 18683672
1,3-diaminobutan-2-one (PubChem CID 18683672) has the molecular formula C4H10N2O and a molecular weight of 102.14 g/mol. Its IUPAC name is 1,3-diaminobutan-2-one.
| Compound Name | 1,3-diaminobutan-2-one |
|---|---|
| PubChem CID | 18683672 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 1,3-diaminobutan-2-one |
| SMILES | CC(N)C(=O)CN |
| InChI | InChI=1S/C4H10N2O/c1-3(6)4(7)2-5/h3H,2,5-6H2,1H3 |
| InChIKey | QGXRFSPKWGXYMG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |