C5H12NO3+ — CID 148947555
[(2S,3S)-5-amino-3-hydroxy-4-oxopentan-2-yl]oxidanium (PubChem CID 148947555) has the molecular formula C5H12NO3+ and a molecular weight of 134.15 g/mol. Its IUPAC name is [(2S,3S)-5-amino-3-hydroxy-4-oxopentan-2-yl]oxidanium.
| Compound Name | [(2S,3S)-5-amino-3-hydroxy-4-oxopentan-2-yl]oxidanium |
|---|---|
| PubChem CID | 148947555 |
| Molecular Formula | C5H12NO3+ |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | [(2S,3S)-5-amino-3-hydroxy-4-oxopentan-2-yl]oxidanium |
| SMILES | C[C@H]([OH2+])[C@H](O)C(=O)CN |
| InChI | InChI=1S/C5H11NO3/c1-3(7)5(9)4(8)2-6/h3,5,7,9H,2,6H2,1H3/p+1/t3-,5-/m0/s1 |
| InChIKey | PPFTYFJBDQDNLS-UCORVYFPSA-O |
| XLogP | -2.01 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|