About CID 172688738
CID 172688738 (PubChem CID 172688738) has the molecular formula C6H8KO2S
and a molecular weight of 183.29 g/mol.
Molecular Properties
| Compound Name | CID 172688738 |
| PubChem CID | 172688738 |
| Molecular Formula | C6H8KO2S |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | — |
| SMILES | C=CC(=O)C(C)C(=O)S.[K] |
| InChI | InChI=1S/C6H8O2S.K/c1-3-5(7)4(2)6(8)9;/h3-4H,1H2,2H3,(H,8,9); |
| InChIKey | BJQUDOMOFAPQDR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 172688738 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172688738?
The IUPAC name of CID 172688738 (CID 172688738) is not available.
What is the SMILES notation for CID 172688738?
The canonical SMILES for CID 172688738 is C=CC(=O)C(C)C(=O)S.[K].
What is the InChIKey of CID 172688738?
The InChIKey is BJQUDOMOFAPQDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2S.K/c1-3-5(7)4(2)6(8)9;/h3-4H,1H2,2H3,(H,8,9);.
What are the key properties of CID 172688738?
CID 172688738 has a molecular weight of 183.29 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172688738 is sourced from PubChem (CID 172688738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).