C14H26O3 — CID 158678259
(2R)-2,3-dimethylbutanoic acid;(4R)-4,5-dimethylhex-1-en-3-one (PubChem CID 158678259) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2R)-2,3-dimethylbutanoic acid;(4R)-4,5-dimethylhex-1-en-3-one.
| Compound Name | (2R)-2,3-dimethylbutanoic acid;(4R)-4,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 158678259 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (2R)-2,3-dimethylbutanoic acid;(4R)-4,5-dimethylhex-1-en-3-one |
| SMILES | C=CC(=O)[C@H](C)C(C)C.CC(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H14O.C6H12O2/c1-5-8(9)7(4)6(2)3;1-4(2)5(3)6(7)8/h5-7H,1H2,2-4H3;4-5H,1-3H3,(H,7,8)/t7-;5-/m11/s1 |
| InChIKey | IEUHVBBGCRBSLJ-CTUJMYERSA-N |
| XLogP | 3.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|