C12H24N2O2 — CID 123689568
N-(1-amino-1-oxobutan-2-yl)-N,2,3,3-tetramethylbutanamide (PubChem CID 123689568) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(1-amino-1-oxobutan-2-yl)-N,2,3,3-tetramethylbutanamide.
| Compound Name | N-(1-amino-1-oxobutan-2-yl)-N,2,3,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 123689568 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(1-amino-1-oxobutan-2-yl)-N,2,3,3-tetramethylbutanamide |
| SMILES | CCC(C(N)=O)N(C)C(=O)C(C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-7-9(10(13)15)14(6)11(16)8(2)12(3,4)5/h8-9H,7H2,1-6H3,(H2,13,15) |
| InChIKey | AWPYUJXACFQZNG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |