C18H31F3N2O3 — CID 170631542
N-[2-amino-1-(2,2-dimethylcyclopropyl)-2-oxoethyl]-N,2,3,3-tetramethylbutanamide;1,1,1-trifluoropropan-2-one (PubChem CID 170631542) has the molecular formula C18H31F3N2O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[2-amino-1-(2,2-dimethylcyclopropyl)-2-oxoethyl]-N,2,3,3-tetramethylbutanamide;1,1,1-trifluoropropan-2-one.
| Compound Name | N-[2-amino-1-(2,2-dimethylcyclopropyl)-2-oxoethyl]-N,2,3,3-tetramethylbutanamide;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 170631542 |
| Molecular Formula | C18H31F3N2O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[2-amino-1-(2,2-dimethylcyclopropyl)-2-oxoethyl]-N,2,3,3-tetramethylbutanamide;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.CC(C(=O)N(C)C(C(N)=O)C1CC1(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O2.C3H3F3O/c1-9(14(2,3)4)13(19)17(7)11(12(16)18)10-8-15(10,5)6;1-2(7)3(4,5)6/h9-11H,8H2,1-7H3,(H2,16,18);1H3 |
| InChIKey | XKQHSUQFZMNXJA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |