C7H11N5O — CID 137262438
3-[(E)-1H-imidazol-5-ylmethylideneamino]-1,1-dimethylurea (PubChem CID 137262438) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-[(E)-1H-imidazol-5-ylmethylideneamino]-1,1-dimethylurea.
| Compound Name | 3-[(E)-1H-imidazol-5-ylmethylideneamino]-1,1-dimethylurea |
|---|---|
| PubChem CID | 137262438 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 3-[(E)-1H-imidazol-5-ylmethylideneamino]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N/N=C/c1cnc[nH]1 |
| InChI | InChI=1S/C7H11N5O/c1-12(2)7(13)11-10-4-6-3-8-5-9-6/h3-5H,1-2H3,(H,8,9)(H,11,13)/b10-4+ |
| InChIKey | XAPBJBVTDSEQEU-ONNFQVAWSA-N |
| XLogP | 0.01 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|