C14H12N6 — CID 137270215
1-(1H-imidazol-5-yl)-N-[4-(1H-imidazol-5-ylmethylideneamino)phenyl]methanimine (PubChem CID 137270215) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-[4-(1H-imidazol-5-ylmethylideneamino)phenyl]methanimine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-[4-(1H-imidazol-5-ylmethylideneamino)phenyl]methanimine |
|---|---|
| PubChem CID | 137270215 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-[4-(1H-imidazol-5-ylmethylideneamino)phenyl]methanimine |
| SMILES | C(=N/c1ccc(/N=C/c2cnc[nH]2)cc1)\c1cnc[nH]1 |
| InChI | InChI=1S/C14H12N6/c1-2-12(18-8-14-6-16-10-20-14)4-3-11(1)17-7-13-5-15-9-19-13/h1-10H,(H,15,19)(H,16,20)/b17-7+,18-8+ |
| InChIKey | SIKGIHRCGHMQBE-ZEELXFFVSA-N |
| XLogP | 2.63 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|