C22H33N3O2 — CID 136859596
N-(3,4-dihexoxyphenyl)-1-(1H-imidazol-5-yl)methanimine (PubChem CID 136859596) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-(3,4-dihexoxyphenyl)-1-(1H-imidazol-5-yl)methanimine.
| Compound Name | N-(3,4-dihexoxyphenyl)-1-(1H-imidazol-5-yl)methanimine |
|---|---|
| PubChem CID | 136859596 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(3,4-dihexoxyphenyl)-1-(1H-imidazol-5-yl)methanimine |
| SMILES | CCCCCCOc1ccc(/N=C/c2cnc[nH]2)cc1OCCCCCC |
| InChI | InChI=1S/C22H33N3O2/c1-3-5-7-9-13-26-21-12-11-19(24-17-20-16-23-18-25-20)15-22(21)27-14-10-8-6-4-2/h11-12,15-18H,3-10,13-14H2,1-2H3,(H,23,25)/b24-17+ |
| InChIKey | NJYHHDKIZBCYQP-JJIBRWJFSA-N |
| XLogP | 6.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|