C8H14N4 — CID 136726194
2-(1H-imidazol-5-ylmethylideneamino)-N,N-dimethylethanamine (PubChem CID 136726194) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-(1H-imidazol-5-ylmethylideneamino)-N,N-dimethylethanamine.
| Compound Name | 2-(1H-imidazol-5-ylmethylideneamino)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 136726194 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-(1H-imidazol-5-ylmethylideneamino)-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C/c1cnc[nH]1 |
| InChI | InChI=1S/C8H14N4/c1-12(2)4-3-9-5-8-6-10-7-11-8/h5-7H,3-4H2,1-2H3,(H,10,11)/b9-5+ |
| InChIKey | LHHBDPNHEMQPKW-WEVVVXLNSA-N |
| XLogP | 0.39 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|