C10H21N3 — CID 144593891
N,N-dimethylbutan-1-amine;5-methyl-1H-imidazole (PubChem CID 144593891) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;5-methyl-1H-imidazole.
| Compound Name | N,N-dimethylbutan-1-amine;5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 144593891 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N,N-dimethylbutan-1-amine;5-methyl-1H-imidazole |
| SMILES | CCCCN(C)C.Cc1cnc[nH]1 |
| InChI | InChI=1S/C6H15N.C4H6N2/c1-4-5-6-7(2)3;1-4-2-5-3-6-4/h4-6H2,1-3H3;2-3H,1H3,(H,5,6) |
| InChIKey | KTJFCVNWEQMXLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |