C8H19N5 — CID 86084386
N,N-dimethylbutan-1-amine;5-methyl-2H-tetrazole (PubChem CID 86084386) has the molecular formula C8H19N5 and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;5-methyl-2H-tetrazole.
| Compound Name | N,N-dimethylbutan-1-amine;5-methyl-2H-tetrazole |
|---|---|
| PubChem CID | 86084386 |
| Molecular Formula | C8H19N5 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | N,N-dimethylbutan-1-amine;5-methyl-2H-tetrazole |
| SMILES | CCCCN(C)C.Cc1nn[nH]n1 |
| InChI | InChI=1S/C6H15N.C2H4N4/c1-4-5-6-7(2)3;1-2-3-5-6-4-2/h4-6H2,1-3H3;1H3,(H,3,4,5,6) |
| InChIKey | FIQXCUIPIPGYIK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |