C5H11N5 — CID 158635982
5-methyl-2H-tetrazole;prop-1-en-2-amine (PubChem CID 158635982) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is 5-methyl-2H-tetrazole;prop-1-en-2-amine.
| Compound Name | 5-methyl-2H-tetrazole;prop-1-en-2-amine |
|---|---|
| PubChem CID | 158635982 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-methyl-2H-tetrazole;prop-1-en-2-amine |
| SMILES | C=C(C)N.Cc1nn[nH]n1 |
| InChI | InChI=1S/C3H7N.C2H4N4/c1-3(2)4;1-2-3-5-6-4-2/h1,4H2,2H3;1H3,(H,3,4,5,6) |
| InChIKey | HZTUGHWQXKMLTE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |