C5H6N6 — CID 14063065
(E)-3-amino-2-(2H-tetrazol-5-yl)but-2-enenitrile (PubChem CID 14063065) has the molecular formula C5H6N6 and a molecular weight of 150.14 g/mol. Its IUPAC name is (E)-3-amino-2-(2H-tetrazol-5-yl)but-2-enenitrile.
| Compound Name | (E)-3-amino-2-(2H-tetrazol-5-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 14063065 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (E)-3-amino-2-(2H-tetrazol-5-yl)but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C5H6N6/c1-3(7)4(2-6)5-8-10-11-9-5/h7H2,1H3,(H,8,9,10,11)/b4-3+ |
| InChIKey | VRNSMPFGINCBOV-ONEGZZNKSA-N |
| XLogP | -0.59 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|