C13H19N3O — CID 175322910
2-[(dimethylamino)methyl]phenol;5-methyl-1H-imidazole (PubChem CID 175322910) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]phenol;5-methyl-1H-imidazole.
| Compound Name | 2-[(dimethylamino)methyl]phenol;5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 175322910 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-[(dimethylamino)methyl]phenol;5-methyl-1H-imidazole |
| SMILES | CN(C)Cc1ccccc1O.Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H13NO.C4H6N2/c1-10(2)7-8-5-3-4-6-9(8)11;1-4-2-5-3-6-4/h3-6,11H,7H2,1-2H3;2-3H,1H3,(H,5,6) |
| InChIKey | YNWDADDMGZWCMA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|