About 2-[(dimethylamino)methyl]phenol;4-methylmorpholine
2-[(dimethylamino)methyl]phenol;4-methylmorpholine (PubChem CID 160689906) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]phenol;4-methylmorpholine.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]phenol;4-methylmorpholine |
| PubChem CID | 160689906 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[(dimethylamino)methyl]phenol;4-methylmorpholine |
| SMILES | CN(C)Cc1ccccc1O.CN1CCOCC1 |
| InChI | InChI=1S/C9H13NO.C5H11NO/c1-10(2)7-8-5-3-4-6-9(8)11;1-6-2-4-7-5-3-6/h3-6,11H,7H2,1-2H3;2-5H2,1H3 |
| InChIKey | RPGPWXSREYFXQW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(dimethylamino)methyl]phenol;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]phenol;4-methylmorpholine?
The IUPAC name of 2-[(dimethylamino)methyl]phenol;4-methylmorpholine (CID 160689906) is 2-[(dimethylamino)methyl]phenol;4-methylmorpholine.
What is the SMILES notation for 2-[(dimethylamino)methyl]phenol;4-methylmorpholine?
The canonical SMILES for 2-[(dimethylamino)methyl]phenol;4-methylmorpholine is CN(C)Cc1ccccc1O.CN1CCOCC1.
What is the InChIKey of 2-[(dimethylamino)methyl]phenol;4-methylmorpholine?
The InChIKey is RPGPWXSREYFXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C5H11NO/c1-10(2)7-8-5-3-4-6-9(8)11;1-6-2-4-7-5-3-6/h3-6,11H,7H2,1-2H3;2-5H2,1H3.
What are the key properties of 2-[(dimethylamino)methyl]phenol;4-methylmorpholine?
2-[(dimethylamino)methyl]phenol;4-methylmorpholine has a molecular weight of 252.36 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]phenol;4-methylmorpholine is sourced from PubChem (CID 160689906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).