C16H16N6 — CID 137147559
1-(1H-imidazol-5-yl)-N-[[3-[(1H-imidazol-5-ylmethylideneamino)methyl]phenyl]methyl]methanimine (PubChem CID 137147559) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-[[3-[(1H-imidazol-5-ylmethylideneamino)methyl]phenyl]methyl]methanimine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-[[3-[(1H-imidazol-5-ylmethylideneamino)methyl]phenyl]methyl]methanimine |
|---|---|
| PubChem CID | 137147559 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-[[3-[(1H-imidazol-5-ylmethylideneamino)methyl]phenyl]methyl]methanimine |
| SMILES | C(=N/Cc1cccc(C/N=C/c2cnc[nH]2)c1)\c1cnc[nH]1 |
| InChI | InChI=1S/C16H16N6/c1-2-13(5-17-7-15-9-19-11-21-15)4-14(3-1)6-18-8-16-10-20-12-22-16/h1-4,7-12H,5-6H2,(H,19,21)(H,20,22)/b17-7+,18-8+ |
| InChIKey | QYRLKDAPVMHNIK-ZEELXFFVSA-N |
| XLogP | 2.37 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|