C10H18N4O — CID 115747411
2-(1H-imidazol-5-ylmethylamino)-N,3-dimethylbutanamide (PubChem CID 115747411) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(1H-imidazol-5-ylmethylamino)-N,3-dimethylbutanamide.
| Compound Name | 2-(1H-imidazol-5-ylmethylamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115747411 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-(1H-imidazol-5-ylmethylamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(NCc1cnc[nH]1)C(C)C |
| InChI | InChI=1S/C10H18N4O/c1-7(2)9(10(15)11-3)13-5-8-4-12-6-14-8/h4,6-7,9,13H,5H2,1-3H3,(H,11,15)(H,12,14) |
| InChIKey | WAHQDIMISSGRQB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |