C13H22N4O2 — CID 21056271
N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide (PubChem CID 21056271) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide.
| Compound Name | N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 21056271 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |
| SMILES | CNC(C(=O)NC(Cc1cnc[nH]1)C(C)=O)C(C)C |
| InChI | InChI=1S/C13H22N4O2/c1-8(2)12(14-4)13(19)17-11(9(3)18)5-10-6-15-7-16-10/h6-8,11-12,14H,5H2,1-4H3,(H,15,16)(H,17,19) |
| InChIKey | HTCORWYMJBBEIP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |