C12H21N7O2 — CID 54561948
3-(diaminomethylideneamino)-N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-2-(methylamino)propanamide (PubChem CID 54561948) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-2-(methylamino)propanamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 54561948 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[1-(1H-imidazol-5-yl)-3-oxobutan-2-yl]-2-(methylamino)propanamide |
| SMILES | CNC(CN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(C)=O |
| InChI | InChI=1S/C12H21N7O2/c1-7(20)9(3-8-4-16-6-18-8)19-11(21)10(15-2)5-17-12(13)14/h4,6,9-10,15H,3,5H2,1-2H3,(H,16,18)(H,19,21)(H4,13,14,17) |
| InChIKey | ZREDRTACJWULNO-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|