C15H26N8O4 — CID 18218278
2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18218278) has the molecular formula C15H26N8O4 and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18218278 |
| Molecular Formula | C15H26N8O4 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C15H26N8O4/c1-8(16)12(24)22-10(3-2-4-20-15(17)18)13(25)23-11(14(26)27)5-9-6-19-7-21-9/h6-8,10-11H,2-5,16H2,1H3,(H,19,21)(H,22,24)(H,23,25)(H,26,27)(H4,17,18,20) |
| InChIKey | KVWLTGNCJYDJET-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 214.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|