C15H26N8O4S — CID 145454643
(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 145454643) has the molecular formula C15H26N8O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 145454643 |
| Molecular Formula | C15H26N8O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C15H26N8O4S/c16-9(6-28)12(24)22-10(2-1-3-20-15(17)18)13(25)23-11(14(26)27)4-8-5-19-7-21-8/h5,7,9-11,28H,1-4,6,16H2,(H,19,21)(H,22,24)(H,23,25)(H,26,27)(H4,17,18,20)/t9-,10-,11-/m0/s1 |
| InChIKey | LRZPRGJXAZFXCR-DCAQKATOSA-N |
| XLogP | -2.68 |
| TPSA | 214.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|