C21H33N11O5S — CID 18243856
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18243856) has the molecular formula C21H33N11O5S and a molecular weight of 551.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18243856 |
| Molecular Formula | C21H33N11O5S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C21H33N11O5S/c22-13(2-1-3-27-21(23)24)17(33)30-14(4-11-6-25-9-28-11)18(34)31-15(5-12-7-26-10-29-12)19(35)32-16(8-38)20(36)37/h6-7,9-10,13-16,38H,1-5,8,22H2,(H,25,28)(H,26,29)(H,30,33)(H,31,34)(H,32,35)(H,36,37)(H4,23,24,27) |
| InChIKey | DKVMDPFAOLSFEX-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 272.38 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|