C20H34N10O6S — CID 22701057
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 22701057) has the molecular formula C20H34N10O6S and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 22701057 |
| Molecular Formula | C20H34N10O6S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C20H34N10O6S/c21-11(3-4-15(22)31)16(32)28-12(2-1-5-26-20(23)24)17(33)30-14(8-37)18(34)29-13(19(35)36)6-10-7-25-9-27-10/h7,9,11-14,37H,1-6,8,21H2,(H2,22,31)(H,25,27)(H,28,32)(H,29,34)(H,30,33)(H,35,36)(H4,23,24,26) |
| InChIKey | JNAJOWXLESOPOG-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|