C18H31N9O5S2 — CID 18242272
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18242272) has the molecular formula C18H31N9O5S2 and a molecular weight of 517.64 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18242272 |
| Molecular Formula | C18H31N9O5S2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H31N9O5S2/c19-10(2-1-3-23-18(20)21)14(28)26-12(6-33)16(30)25-11(4-9-5-22-8-24-9)15(29)27-13(7-34)17(31)32/h5,8,10-13,33-34H,1-4,6-7,19H2,(H,22,24)(H,25,30)(H,26,28)(H,27,29)(H,31,32)(H4,20,21,23) |
| InChIKey | GTMBIJBGDLNELX-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|