C16H28N2O2 — CID 166318346
(E)-N-(2,6-dimethylcyclohexyl)-4-morpholin-4-ylbut-2-enamide (PubChem CID 166318346) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylcyclohexyl)-4-morpholin-4-ylbut-2-enamide.
| Compound Name | (E)-N-(2,6-dimethylcyclohexyl)-4-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 166318346 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (E)-N-(2,6-dimethylcyclohexyl)-4-morpholin-4-ylbut-2-enamide |
| SMILES | CC1CCCC(C)C1NC(=O)/C=C/CN1CCOCC1 |
| InChI | InChI=1S/C16H28N2O2/c1-13-5-3-6-14(2)16(13)17-15(19)7-4-8-18-9-11-20-12-10-18/h4,7,13-14,16H,3,5-6,8-12H2,1-2H3,(H,17,19)/b7-4+ |
| InChIKey | YUCLMOQFPKKCAO-QPJJXVBHSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|