C6H12N2O3 — CID 175586464
N'-(2-hydroxybutyl)oxamide (PubChem CID 175586464) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is N'-(2-hydroxybutyl)oxamide.
| Compound Name | N'-(2-hydroxybutyl)oxamide |
|---|---|
| PubChem CID | 175586464 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N'-(2-hydroxybutyl)oxamide |
| SMILES | CCC(O)CNC(=O)C(N)=O |
| InChI | InChI=1S/C6H12N2O3/c1-2-4(9)3-8-6(11)5(7)10/h4,9H,2-3H2,1H3,(H2,7,10)(H,8,11) |
| InChIKey | UBLGKOMDKOEVDN-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|