C24H48N2O3 — CID 163496869
2,7-ditert-butyl-N'-(2-hydroxybutyl)-4,4,5,5-tetramethyloctanediamide (PubChem CID 163496869) has the molecular formula C24H48N2O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2,7-ditert-butyl-N'-(2-hydroxybutyl)-4,4,5,5-tetramethyloctanediamide.
| Compound Name | 2,7-ditert-butyl-N'-(2-hydroxybutyl)-4,4,5,5-tetramethyloctanediamide |
|---|---|
| PubChem CID | 163496869 |
| Molecular Formula | C24H48N2O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 2,7-ditert-butyl-N'-(2-hydroxybutyl)-4,4,5,5-tetramethyloctanediamide |
| SMILES | CCC(O)CNC(=O)C(CC(C)(C)C(C)(C)CC(C(N)=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H48N2O3/c1-12-16(27)15-26-20(29)18(22(5,6)7)14-24(10,11)23(8,9)13-17(19(25)28)21(2,3)4/h16-18,27H,12-15H2,1-11H3,(H2,25,28)(H,26,29) |
| InChIKey | CRMFYGWJKJJREJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |