C12H26N2O2 — CID 103827723
2-amino-N-(2-hydroxy-4-methylpentyl)-3,3-dimethylbutanamide (PubChem CID 103827723) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-4-methylpentyl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(2-hydroxy-4-methylpentyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103827723 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-N-(2-hydroxy-4-methylpentyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)CC(O)CNC(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-8(2)6-9(15)7-14-11(16)10(13)12(3,4)5/h8-10,15H,6-7,13H2,1-5H3,(H,14,16) |
| InChIKey | OGBQLGIUZSWHJB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |