C10H22N2O2S — CID 104865583
(2S)-2-amino-3,3-dimethyl-N-(2-methylsulfinylpropyl)butanamide (PubChem CID 104865583) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-(2-methylsulfinylpropyl)butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-(2-methylsulfinylpropyl)butanamide |
|---|---|
| PubChem CID | 104865583 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-(2-methylsulfinylpropyl)butanamide |
| SMILES | CC(CNC(=O)[C@@H](N)C(C)(C)C)S(C)=O |
| InChI | InChI=1S/C10H22N2O2S/c1-7(15(5)14)6-12-9(13)8(11)10(2,3)4/h7-8H,6,11H2,1-5H3,(H,12,13)/t7?,8-,15?/m1/s1 |
| InChIKey | YMAZKVSRAYKAIB-HDGJIZGZSA-N |
| XLogP | 0.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |