C8H14O3 — CID 23542538
(Z)-4,6-dihydroxyoct-3-en-2-one (PubChem CID 23542538) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (Z)-4,6-dihydroxyoct-3-en-2-one.
| Compound Name | (Z)-4,6-dihydroxyoct-3-en-2-one |
|---|---|
| PubChem CID | 23542538 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (Z)-4,6-dihydroxyoct-3-en-2-one |
| SMILES | CCC(O)C/C(O)=C/C(C)=O |
| InChI | InChI=1S/C8H14O3/c1-3-7(10)5-8(11)4-6(2)9/h4,7,10-11H,3,5H2,1-2H3/b8-4- |
| InChIKey | YIRRQTTUYDDKGN-YWEYNIOJSA-N |
| XLogP | 1.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|