C8H11NO3 — CID 157402016
(Z,6S)-4,6-dihydroxy-7-isocyanohept-3-en-2-one (PubChem CID 157402016) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (Z,6S)-4,6-dihydroxy-7-isocyanohept-3-en-2-one.
| Compound Name | (Z,6S)-4,6-dihydroxy-7-isocyanohept-3-en-2-one |
|---|---|
| PubChem CID | 157402016 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (Z,6S)-4,6-dihydroxy-7-isocyanohept-3-en-2-one |
| SMILES | [C-]#[N+]C[C@@H](O)C/C(O)=C/C(C)=O |
| InChI | InChI=1S/C8H11NO3/c1-6(10)3-7(11)4-8(12)5-9-2/h3,8,11-12H,4-5H2,1H3/b7-3-/t8-/m0/s1 |
| InChIKey | ATEBUSAEABNOMX-PFPYCLJUSA-N |
| XLogP | 0.69 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|