C24H50O6 — CID 86620073
[(2S,3R)-2,3,4-trihydroxybutyl] 3,7,11,15-tetramethylhexadecanoate;hydrate (PubChem CID 86620073) has the molecular formula C24H50O6 and a molecular weight of 434.66 g/mol. Its IUPAC name is [(2S,3R)-2,3,4-trihydroxybutyl] 3,7,11,15-tetramethylhexadecanoate;hydrate.
| Compound Name | [(2S,3R)-2,3,4-trihydroxybutyl] 3,7,11,15-tetramethylhexadecanoate;hydrate |
|---|---|
| PubChem CID | 86620073 |
| Molecular Formula | C24H50O6 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | [(2S,3R)-2,3,4-trihydroxybutyl] 3,7,11,15-tetramethylhexadecanoate;hydrate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)OC[C@H](O)[C@H](O)CO.O |
| InChI | InChI=1S/C24H48O5.H2O/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-24(28)29-17-23(27)22(26)16-25;/h18-23,25-27H,6-17H2,1-5H3;1H2/t19?,20?,21?,22-,23+;/m1./s1 |
| InChIKey | LOUSBUGMPDKKHW-GURDZIKKSA-N |
| XLogP | 3.88 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |