About N-methoxy-N,3-dimethyldec-2-enamide
N-methoxy-N,3-dimethyldec-2-enamide (PubChem CID 142294776) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-methoxy-N,3-dimethyldec-2-enamide.
Molecular Properties
| Compound Name | N-methoxy-N,3-dimethyldec-2-enamide |
| PubChem CID | 142294776 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-methoxy-N,3-dimethyldec-2-enamide |
| SMILES | CCCCCCCC(C)=CC(=O)N(C)OC |
| InChI | InChI=1S/C13H25NO2/c1-5-6-7-8-9-10-12(2)11-13(15)14(3)16-4/h11H,5-10H2,1-4H3 |
| InChIKey | WUBCLVIKSAJALT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,3-dimethyldec-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,3-dimethyldec-2-enamide?
The IUPAC name of N-methoxy-N,3-dimethyldec-2-enamide (CID 142294776) is N-methoxy-N,3-dimethyldec-2-enamide.
What is the SMILES notation for N-methoxy-N,3-dimethyldec-2-enamide?
The canonical SMILES for N-methoxy-N,3-dimethyldec-2-enamide is CCCCCCCC(C)=CC(=O)N(C)OC.
What is the InChIKey of N-methoxy-N,3-dimethyldec-2-enamide?
The InChIKey is WUBCLVIKSAJALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-5-6-7-8-9-10-12(2)11-13(15)14(3)16-4/h11H,5-10H2,1-4H3.
What are the key properties of N-methoxy-N,3-dimethyldec-2-enamide?
N-methoxy-N,3-dimethyldec-2-enamide has a molecular weight of 227.35 g/mol, XLogP of 3.31, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,3-dimethyldec-2-enamide is sourced from PubChem (CID 142294776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).