C14H17Cl3O2 — CID 140728335
1,1,1-trichloro-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one (PubChem CID 140728335) has the molecular formula C14H17Cl3O2 and a molecular weight of 323.65 g/mol. Its IUPAC name is 1,1,1-trichloro-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one.
| Compound Name | 1,1,1-trichloro-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 140728335 |
| Molecular Formula | C14H17Cl3O2 |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1,1,1-trichloro-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one |
| SMILES | CCC(C)C=CC=CC=CC(O)=CC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl3O2/c1-3-11(2)8-6-4-5-7-9-12(18)10-13(19)14(15,16)17/h4-11,18H,3H2,1-2H3 |
| InChIKey | XOJPDOWNAJBCPS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|