C18H20S — CID 155691022
2-[(3Z,5Z)-7-methylnona-1,3,5-trien-2-yl]-1-benzothiophene (PubChem CID 155691022) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-[(3Z,5Z)-7-methylnona-1,3,5-trien-2-yl]-1-benzothiophene.
| Compound Name | 2-[(3Z,5Z)-7-methylnona-1,3,5-trien-2-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 155691022 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[(3Z,5Z)-7-methylnona-1,3,5-trien-2-yl]-1-benzothiophene |
| SMILES | C=C(/C=C\C=C/C(C)CC)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H20S/c1-4-14(2)9-5-6-10-15(3)18-13-16-11-7-8-12-17(16)19-18/h5-14H,3-4H2,1-2H3/b9-5-,10-6- |
| InChIKey | VOAKQFJFJOOPCC-OZDSWYPASA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|