C15H20OS — CID 114910768
2-(1-benzothiophen-2-yl)-4-methylhexan-2-ol (PubChem CID 114910768) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-4-methylhexan-2-ol.
| Compound Name | 2-(1-benzothiophen-2-yl)-4-methylhexan-2-ol |
|---|---|
| PubChem CID | 114910768 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-4-methylhexan-2-ol |
| SMILES | CCC(C)CC(C)(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H20OS/c1-4-11(2)10-15(3,16)14-9-12-7-5-6-8-13(12)17-14/h5-9,11,16H,4,10H2,1-3H3 |
| InChIKey | ZDHVUHOUGZZXRI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |