C14H18S — CID 23150201
2-(2,3-dimethylbutan-2-yl)-1-benzothiophene (PubChem CID 23150201) has the molecular formula C14H18S and a molecular weight of 218.37 g/mol. Its IUPAC name is 2-(2,3-dimethylbutan-2-yl)-1-benzothiophene.
| Compound Name | 2-(2,3-dimethylbutan-2-yl)-1-benzothiophene |
|---|---|
| PubChem CID | 23150201 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-(2,3-dimethylbutan-2-yl)-1-benzothiophene |
| SMILES | CC(C)C(C)(C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H18S/c1-10(2)14(3,4)13-9-11-7-5-6-8-12(11)15-13/h5-10H,1-4H3 |
| InChIKey | IJKYBELXYKBKOO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |