C12H15NO3S2 — CID 99980288
N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]methanesulfonamide (PubChem CID 99980288) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]methanesulfonamide.
| Compound Name | N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]methanesulfonamide |
|---|---|
| PubChem CID | 99980288 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[(2R)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]methanesulfonamide |
| SMILES | C[C@@](O)(CNS(C)(=O)=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C12H15NO3S2/c1-12(14,8-13-18(2,15)16)11-7-9-5-3-4-6-10(9)17-11/h3-7,13-14H,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | DSFWZYQKRDYJFE-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |