C17H16FNO3S2 — CID 86264004
N-[2-(1-benzothiophen-2-yl)-2-hydroxypropyl]-2-fluorobenzenesulfonamide (PubChem CID 86264004) has the molecular formula C17H16FNO3S2 and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-2-yl)-2-hydroxypropyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[2-(1-benzothiophen-2-yl)-2-hydroxypropyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 86264004 |
| Molecular Formula | C17H16FNO3S2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[2-(1-benzothiophen-2-yl)-2-hydroxypropyl]-2-fluorobenzenesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)c1ccccc1F)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H16FNO3S2/c1-17(20,16-10-12-6-2-4-8-14(12)23-16)11-19-24(21,22)15-9-5-3-7-13(15)18/h2-10,19-20H,11H2,1H3 |
| InChIKey | XCDVOBFDAXUQAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |