C13H15NO2S — CID 99979783
N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]acetamide (PubChem CID 99979783) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]acetamide.
| Compound Name | N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 99979783 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-[(2S)-2-(1-benzothiophen-2-yl)-2-hydroxypropyl]acetamide |
| SMILES | CC(=O)NC[C@](C)(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H15NO2S/c1-9(15)14-8-13(2,16)12-7-10-5-3-4-6-11(10)17-12/h3-7,16H,8H2,1-2H3,(H,14,15)/t13-/m0/s1 |
| InChIKey | DZZOPOGCYYBIGO-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |