C13H5N3S — CID 142772580
2-(1-benzothiophen-2-yl)ethene-1,1,2-tricarbonitrile (PubChem CID 142772580) has the molecular formula C13H5N3S and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(1-benzothiophen-2-yl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 142772580 |
| Molecular Formula | C13H5N3S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H5N3S/c14-6-10(7-15)11(8-16)13-5-9-3-1-2-4-12(9)17-13/h1-5H |
| InChIKey | DQWRCPZFJWAKOR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|