C8H13Cl6NO4 — CID 175365638
propan-2-amine;2,2,2-trichloroacetic acid;2,2,3-trichloropropanoic acid (PubChem CID 175365638) has the molecular formula C8H13Cl6NO4 and a molecular weight of 399.91 g/mol. Its IUPAC name is propan-2-amine;2,2,2-trichloroacetic acid;2,2,3-trichloropropanoic acid.
| Compound Name | propan-2-amine;2,2,2-trichloroacetic acid;2,2,3-trichloropropanoic acid |
|---|---|
| PubChem CID | 175365638 |
| Molecular Formula | C8H13Cl6NO4 |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | propan-2-amine;2,2,2-trichloroacetic acid;2,2,3-trichloropropanoic acid |
| SMILES | CC(C)N.O=C(O)C(Cl)(Cl)CCl.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H3Cl3O2.C3H9N.C2HCl3O2/c4-1-3(5,6)2(7)8;1-3(2)4;3-2(4,5)1(6)7/h1H2,(H,7,8);3H,4H2,1-2H3;(H,6,7) |
| InChIKey | ISJKFRAPXBHAFH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|