C9H10Cl9NO5 — CID 173298655
(2S)-2-aminopropanoic acid;tris(2,2,2-trichloroacetaldehyde) (PubChem CID 173298655) has the molecular formula C9H10Cl9NO5 and a molecular weight of 531.26 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;tris(2,2,2-trichloroacetaldehyde).
| Compound Name | (2S)-2-aminopropanoic acid;tris(2,2,2-trichloroacetaldehyde) |
|---|---|
| PubChem CID | 173298655 |
| Molecular Formula | C9H10Cl9NO5 |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 526.78 |
| IUPAC Name | (2S)-2-aminopropanoic acid;tris(2,2,2-trichloroacetaldehyde) |
| SMILES | C[C@H](N)C(=O)O.O=CC(Cl)(Cl)Cl.O=CC(Cl)(Cl)Cl.O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H7NO2.3C2HCl3O/c1-2(4)3(5)6;3*3-2(4,5)1-6/h2H,4H2,1H3,(H,5,6);3*1H/t2-;;;/m0.../s1 |
| InChIKey | CFOUYRSZIOKBAS-SQGDDOFFSA-N |
| XLogP | 4.08 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|